| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | 9-Mesityl-10-methylacridinium perchlorate |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.88 |
| CAS Registry Number | 674783-97-2 |
| SMILES | [O-]Cl(=O)(=O)=O.c3c2c(c1ccccc1[n+](c2ccc3)C)c4c(cc(cc4C)C)C |
| InChI | 1S/C23H22N.ClHO4/c1-15-13-16(2)22(17(3)14-15)23-18-9-5-7-11-20(18)24(4)21-12-8-6-10-19(21)23;2-1(3,4)5/h5-14H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LFMBERYWDLWXNO-UHFFFAOYSA-M |
| Refractive index | (Cal.) |
|---|---|
| SDS | Available |
|---|---|
| Market Analysis Reports |