| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| OX CHEM | USA | |||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| TOKU-E Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (360) 734-1789 | |||
![]() |
info@toku-e.com | |||
| Chemical manufacturer | ||||
| Name | (2Z,4E)-5-[(1S)-1-Hydroxy-2,6,6-Trimethyl-4-Oxo-2-Cyclohexen-1-Yl]-3-Methyl-2,4-Pentadienoic Acid |
|---|---|
| Synonyms | (+)-(S)-ABA; (+)-S-ABA; (2Z,4E)-5 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 6755-41-5 |
| SMILES | CC1=CC(=O)CC([C@]1(/C=C/C(=C\C(=O)O)/C)O)(C)C |
| InChI | 1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1 |
| InChIKey | JLIDBLDQVAYHNE-YKALOCIXSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 245.4±25.2°C (Cal.) |
| (1) | Avijit Pramanik, Subhojit Majumdar and Gopal Das. Aryl azo imidazoles assisted assembly of anion/anion–water through salt formation, CrystEngComm, 2010, 12, 250. |
|---|---|
| Market Analysis Reports |