|
CAS#: 6763-46-8 Product: [(2R,3S,4S,5R)-1,2,4,5-Tetraacetyloxy-6-Oxo-Hexan-3-Yl] Acetate No suppilers available for the product. |
| Name | [(2R,3S,4S,5R)-1,2,4,5-Tetraacetyloxy-6-Oxo-Hexan-3-Yl] Acetate |
|---|---|
| Synonyms | [(1S,2S,3R)-2,3-Diacetoxy-1-[(1R)-1,2-Diacetoxyethyl]-4-Oxo-Butyl] Acetate; Acetic Acid [(1S,2S,3R)-2,3-Diacetoxy-1-[(1R)-1,2-Diacetoxyethyl]-4-Oxobutyl] Ester; Acetic Acid [(1S,2S,3R)-2,3-Diacetoxy-1-[(1R)-1,2-Diacetoxyethyl]-4-Keto-Butyl] Ester |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 |
| CAS Registry Number | 6763-46-8 |
| SMILES | [C@@H](OC(=O)C)([C@H](OC(=O)C)[C@@H](OC(=O)C)C=O)[C@H](OC(=O)C)COC(=O)C |
| InChI | 1S/C16H22O11/c1-8(18)23-7-14(25-10(3)20)16(27-12(5)22)15(26-11(4)21)13(6-17)24-9(2)19/h6,13-16H,7H2,1-5H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | UAOKXEHOENRFMP-JJXSEGSLSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.023°C at 760 mmHg (Cal.) |
| Flash point | 205.153°C (Cal.) |
| (1) | Mads H. Clausen, Malene R. Jørgensen, Jesper Thorsen and Robert Madsen. A strategy for chemical synthesis of selectively methyl-esterified oligomers of galacturonic acid, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 543. |
|---|---|
| Market Analysis Reports |