|
CAS#: 67785-72-2 Product: 1-(Dimethoxymethyl)-4-(1-Methylethyl)-Benzene No suppilers available for the product. |
| Name | 1-(Dimethoxymethyl)-4-(1-Methylethyl)-Benzene |
|---|---|
| Synonyms | 1-(Dimethoxymethyl)-4-Isopropyl-Benzene; 1-(Dimethoxymethyl)-4-Isopropylbenzene; 1-(Dimethoxymethyl)-4-Propan-2-Yl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 67785-72-2 |
| SMILES | C1=C(C=CC(=C1)C(OC)OC)C(C)C |
| InChI | 1S/C12H18O2/c1-9(2)10-5-7-11(8-6-10)12(13-3)14-4/h5-9,12H,1-4H3 |
| InChIKey | MKTYGYDXBXBRFK-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.499°C at 760 mmHg (Cal.) |
| Flash point | 68.237°C (Cal.) |
| (1) | Phillip D. R. Rose and Andrew Williams. Reactions within association complexes: acid catalysed hydrolysis of substituted benzaldehyde acetals in the presence of detergents, J. Chem. Soc., Perkin Trans. 2, 2002, 0, 1589. |
|---|---|
| Market Analysis Reports |