| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Hydrocarbon halide |
|---|---|
| Name | 1,2,3,4,5-Pentafluoro-6-(1,1,2,3,3-Pentafluoro-2-Propen-1-Yl)-Benzene |
| Synonyms | 3-(Pentafluorophenyl)Pentafluoroprop-1-Ene 98%; 3-(Pentafluorophenyl)Pentafluoroprop-1-Ene98%; 3-(PENTAFLUOROPHENYL)PENTAFLUORO-1-PROPENE |
| Molecular Structure | ![]() |
| Molecular Formula | C9F10 |
| Molecular Weight | 298.08 |
| CAS Registry Number | 67899-41-6 |
| SMILES | FC(=C(C(c1c(F)c(F)c(c(c1F)F)F)(F)F)F)F |
| InChI | 1S/C9F10/c10-2-1(9(18,19)7(15)8(16)17)3(11)5(13)6(14)4(2)12 |
| SDS | Available |
|---|---|
| Market Analysis Reports |