|
CAS#: 67939-70-2 Product: Ethanedial, polymer with (chloromethyl)oxirane and phenol No suppilers available for the product. |
| Name | Ethanedial, polymer with (chloromethyl)oxirane and phenol |
|---|---|
| Synonyms | 2-(Chloromethyl)Oxirane; Ethanedial; Phenol; Ethanedial, Polymer With (Chloromethyl)Oxirane And Phenol; Phenol, Glyoxal Epichlorohydrin Polymer |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 |
| CAS Registry Number | 67939-70-2 |
| SMILES | C(Cl)C1OC1.C2=C(O)C=CC=C2.O=CC=O |
| InChI | 1S/C6H6O.C3H5ClO.C2H2O2/c7-6-4-2-1-3-5-6;4-1-3-2-5-3;3-1-2-4/h1-5,7H;3H,1-2H2;1-2H |
| InChIKey | HZDJEETZHCDZBZ-UHFFFAOYSA-N |
| Boiling point | 181.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 72.5°C (Cal.) |
| Market Analysis Reports |