| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-(4-Bromophenyl)-5-(1-Naphthyl)-1,3,4-Oxadiazole |
|---|---|
| Synonyms | 2-(4-Bromophenyl)-5-(1-Naphthyl)-1,3,4-Oxadiazole; Inchi=1/C18h11brn2o/C19-14-10-8-13(9-11-14)17-20-21-18(22-17)16-7-3-5-12-4-1-2-6-15(12)16/H1-11; St5408764 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H11BrN2O |
| Molecular Weight | 351.20 |
| CAS Registry Number | 68047-37-0 |
| EINECS | 268-288-2 |
| SMILES | C1=CC=C4C(=C1C2=NN=C(O2)C3=CC=C(Br)C=C3)C=CC=C4 |
| InChI | 1S/C18H11BrN2O/c19-14-10-8-13(9-11-14)17-20-21-18(22-17)16-7-3-5-12-4-1-2-6-15(12)16/h1-11H |
| InChIKey | VZEIYIPOCFGTPV-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 146-149°C (Expl.) |
| Boiling point | 507.3±52.0°C at 760 mmHg (Cal.) |
| Flash point | 260.6±30.7°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| (1) | Sushma Singh, Laxmi Kant Sharma, Apoorv Saraswat, Ibadur R. Siddiqui, Harbans K. Kehri and Rana K. Pal Singh. Electrosynthesis and screening of novel 1,3,4-oxadiazoles as potent and selective antifungal agents, RSC Advances, 2013, 3, 4237. |
|---|---|
| Market Analysis Reports |