| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Name | 1,3,5-Trimethyl-1,3,5-trivinylcyclotrisiloxane |
|---|---|
| Synonyms | 2,4,6-Trimethyl-2,4,6-Trivinyl-1,3,5,2,4,6-Trioxatrisilinane; Ai3-62964 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18O3Si3 |
| Molecular Weight | 258.50 |
| CAS Registry Number | 68082-23-5 |
| EINECS | 223-458-5 |
| SMILES | C[Si]1(C=C)O[Si](C=C)(C)O[Si](O1)(C=C)C |
| InChI | 1S/C9H18O3Si3/c1-7-13(4)10-14(5,8-2)12-15(6,9-3)11-13/h7-9H,1-3H2,4-6H3 |
| InChIKey | BVTLTBONLZSBJC-UHFFFAOYSA-N |
| Density | 0.956g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.88°C at 760 mmHg (Cal.) |
| Flash point | 64.231°C (Cal.) |
| Refractive index | 1.4215 (Expl.) |
| (1) | K. Rózga-Wijas, J. Chojnowski, M. Scibiorek and W. Fortuniak. Polysiloxane–silica hybrids from novel precursors by the sol–gel process, J. Mater. Chem., 2005, 15, 2383. |
|---|---|
| Market Analysis Reports |