| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Halogen-containing, sulfur-containing, nitrogen-containing compounds >> Nitrogen-containing compound fragrance |
|---|---|
| Name | 6-(2-Methylpropyl)-Quinoline |
| Synonyms | 6-Isobutylquinoline; 6(Or 8)-(Sec-Butyl)Quinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 68141-26-4 |
| EINECS | 269-204-7 |
| SMILES | C1=C(CC(C)C)C=CC2=C1C=CC=N2 |
| InChI | 1S/C13H15N/c1-10(2)8-11-5-6-13-12(9-11)4-3-7-14-13/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | YKGUUBIPVHRERN-UHFFFAOYSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.082°C at 760 mmHg (Cal.) |
| Flash point | 120.948°C (Cal.) |
| Market Analysis Reports |