| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glutamic acid derivative |
|---|---|
| Name | N-Cocoyl-L-glutamic acid, mono(triethanolamine) salt |
| Synonyms | (2S)-2-Aminoglutaric Acid; 2-(Bis(2-Hydroxyethyl)Amino)Ethanol; L-Glutamic Acid, N-Coco Acyl Derivs, Compds. With Triethanolamine (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H24N2O7 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 68187-29-1 |
| EINECS | 269-084-6 |
| SMILES | [C@@H](N)(C(=O)O)CCC(=O)O.C(N(CCO)CCO)CO |
| InChI | 1S/C6H15NO3.C5H9NO4/c8-4-1-7(2-5-9)3-6-10;6-3(5(9)10)1-2-4(7)8/h8-10H,1-6H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| InChIKey | TUBPSFQENHCYBW-HVDRVSQOSA-N |
| Boiling point | 335.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 185°C (Cal.) |
| Market Analysis Reports |