| Hefei TNJ Chemical Industry Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (551) 6541-8684 | |||
![]() |
sales@tnjchem.com | |||
| Chemical manufacturer since 2001 | ||||
| chemBlink massive supplier since 2021 | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Research Organics Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 321-0570 / (216) 883-8025 | |||
![]() |
info@resorg.com, | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Glutamic acid derivative |
|---|---|
| Name | L-Glutamic Acid, N-Coco Acyl Derivs., Disodium Salts |
| Synonyms | Disodium (2S)-2-Aminoglutarate; Disodium Cocoyl Glutamate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7NNa2O4 |
| Molecular Weight | 191.09 |
| CAS Registry Number | 68187-30-4 (16690-92-9) |
| EINECS | 269-085-1 |
| SMILES | [C@@H](N)(C([O-])=O)CCC([O-])=O.[Na+].[Na+] |
| InChI | 1S/C5H9NO4.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;/q;2*+1/p-2/t3-;;/m0../s1 |
| InChIKey | PXEDJBXQKAGXNJ-QTNFYWBSSA-L |
| Boiling point | 333.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.7°C (Cal.) |
| (1) | J. Lopez-Hernandez. High-performance liquid chromatography for joint determination of the flavour enhancers monosodium glutamate, disodium guanylate and disodium inosinate in dehydrated bouillons., |
|---|---|
| Market Analysis Reports |