|
CAS#: 68370-49-0 Product: (5'aS,3R,5S)-5-(3-Furyl)-3',4,4',5,5',5'a,7',8'-Octahydro-7'alpha-Methylspiro[Furan-3(2H),6'-[6H]Naphtho[1,8-bc]Furan]-2-One No suppilers available for the product. |
| Name | (5'aS,3R,5S)-5-(3-Furyl)-3',4,4',5,5',5'a,7',8'-Octahydro-7'alpha-Methylspiro[Furan-3(2H),6'-[6H]Naphtho[1,8-bc]Furan]-2-One |
|---|---|
| Synonyms | Montanin A |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36 |
| CAS Registry Number | 68370-49-0 |
| SMILES | [C@]13(C(O[C@@H](C1)C2=COC=C2)=O)[C@@H]5C4=C(C[C@H]3C)OC=C4CCC5 |
| InChI | 1S/C19H20O4/c1-11-7-15-17-13(10-22-15)3-2-4-14(17)19(11)8-16(23-18(19)20)12-5-6-21-9-12/h5-6,9-11,14,16H,2-4,7-8H2,1H3/t11-,14+,16+,19-/m1/s1 |
| InChIKey | CZGWUKXZLUIKBU-IUYNRSMJSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.997°C at 760 mmHg (Cal.) |
| Flash point | 255.585°C (Cal.) |
| (1) | I-Chia Chen, Yen-Ku Wu, Hsing-Jang Liu and Jiang-Liang Zhu. Total syntheses of (±)-montanin A and (±)-teuscorolide, Chem. Commun., 2008, 4720. |
|---|---|
| Market Analysis Reports |