| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Creative Peptides | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink massive supplier since 2016 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Classification | Analytical chemistry >> Analytical reagent >> Ion chromatography reagent |
|---|---|
| Name | L-Arginyl-L-Prolyl-L-Prolylglycyl-L-Phenylalanyl-L-Seryl-L-Prolyl-L-Phenylalanyl-L-Arginine |
| Synonyms | (2S)-2-[( |
| Molecular Structure | ![]() |
| Molecular Formula | C50H72N15O11 |
| Molecular Weight | 1060.21 |
| CAS Registry Number | 6846-03-3 |
| SMILES | C1C[C@H](N(C1)C(=O)[C@@H]2CCCN2C(=O)[C@H](CCCNC(=N)N)N)C(=O)NCC(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N[C@@H](CO)C(=O)N4CCC[C@H]4C(=O)N[C@@H](CC5=CC=CC=C5)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | 1S/C50H73N15O11/c51-32(16-7-21-56-49(52)53)45(72)65-25-11-20-39(65)47(74)64-24-9-18-37(64)43(70)58-28-40(67)59-34(26-30-12-3-1-4-13-30)41(68)62-36(29-66)46(73)63-23-10-19-38(63)44(71)61-35(27-31-14-5-2-6-15-31)42(69)60-33(48(75)76)17-8-22-57-50(54)55/h1-6,12-15,32-39,66H,7-11,16-29,51H2,(H,58,70)(H,59,67)(H,60,69)(H,61,71)(H,62,68)(H,75,76)(H4,52,53,56)(H4,54,55,57)/t32-,33-,34-,35-,36-,37-,38-,39-/m0/s1 |
| InChIKey | QXZGBUJJYSLZLT-FDISYFBBSA-N |
| Protein Sequence | H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH acetate salt |
| Description | |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| solubility | Soluble to 1 mg/ml in water |
| SDS | Available |
|---|---|
| (1) | Robert A. Batey and David A. Powell. , Chem. Commun., 2001, 0, 2362. |
|---|---|
| Market Analysis Reports |