| Wuhan Kemi-works Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kemiworks.net | |||
![]() | +86 (27) 8573-6489 | |||
![]() | +86 (27) 8573-6485 | |||
![]() | info@kemiworks.net sales@kemiworks.com | |||
| Chemical manufacturer | ||||
| chemBlink Premium supplier since 2011 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic hafnium, mercury, silver, platinum, etc. |
|---|---|
| Name | Platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane |
| Synonyms | Platinum catalyst |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18OPtSi2 |
| Molecular Weight | 381.48 |
| CAS Registry Number | 68478-92-2 |
| EC Number | 270-844-4 |
| SMILES | C[Si](C)(C=C)O[Si](C)(C)C=C.[Pt] |
| Density | 0.855 g/mL (Expl.) |
|---|---|
| Melting point | 12-13 °C (Expl.) |
| Boiling point | 138 °C (Expl.) |
| Hazard Symbols | |||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H225-H226-H315-H319-H335-H361-H361d-H413 Details | ||||||||||||||||||||||||||||||||||||||||||||||||
| Safety Statements | P203-P210-P233-P240-P241-P242-P243-P261-P264-P264+P265-P271-P273-P280-P302+P352-P303+P361+P353-P304+P340-P305+P351+P338-P318-P319-P321-P332+P317-P337+P317-P362+P364-P370+P378-P403+P233-P403+P235-P405-P501 Details | ||||||||||||||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||
| Transport Information | UN 1307 | ||||||||||||||||||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||||||||||||||||||
|
Platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane is an organoplatinum compound that has found significant applications in various areas of chemistry, particularly in catalytic processes. This substance consists of a platinum(0) center, which is coordinated to a 1,3-divinyl-1,1,3,3-tetramethyldisiloxane ligand. The platinum atom, in its zero oxidation state, plays a crucial role in facilitating a range of chemical reactions, especially those involving organic synthesis and polymerization. The unique combination of platinum and siloxane groups imparts specific reactivity and stability to the compound, making it valuable in many industrial and research applications. The discovery of platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane can be traced to advancements in organometallic chemistry, where platinum compounds were explored for their ability to catalyze reactions. Platinum complexes, particularly those in the zero oxidation state, are well-known for their role as catalysts in a variety of reactions, such as polymerization, hydrogenation, and cross-coupling reactions. The development of platinum-based catalysts has been a key area of research due to platinum's unique electronic properties and ability to facilitate the activation of small molecules. One of the primary applications of platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane is in the field of hydrosilylation reactions. The compound serves as a catalyst in the addition of silicon-hydrogen bonds (Si-H) to alkenes or alkynes, enabling the synthesis of a wide range of siloxane-based compounds. These reactions are particularly important in the production of silicone polymers, which are used in a variety of industries, including automotive, electronics, and medical devices. Platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane is often preferred in hydrosilylation due to its high selectivity, stability, and the ability to operate under mild reaction conditions. In addition to hydrosilylation, platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane is employed in the synthesis of novel materials, particularly those with silicone-based backbones. These materials can exhibit desirable properties such as flexibility, heat resistance, and electrical insulation, which are crucial for applications in electronics and telecommunications. The compound’s versatility as a catalyst allows for the creation of high-performance materials with specific chemical and physical properties, making it valuable in the development of advanced coatings, adhesives, and sealants. Furthermore, platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane finds use in polymerization reactions, where it catalyzes the formation of polymers with controlled molecular weights and narrow molecular distributions. This ability to control polymer architecture makes it essential in the production of specialty polymers with unique properties. Such polymers are utilized in fields ranging from biomedical devices to high-performance films and coatings. Another important application of this platinum complex is in the development of advanced catalytic systems for fine chemical synthesis. Platinum-based catalysts are employed in the production of pharmaceuticals, agrochemicals, and other fine chemicals. The ability of platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane to promote reactions efficiently while maintaining high selectivity makes it an attractive option for these industries, where precision and yield are paramount. In conclusion, platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane is a valuable organoplatinum compound with diverse applications in catalysis, polymer synthesis, and materials science. Its role in hydrosilylation reactions, the production of specialty polymers, and fine chemical synthesis underscores its importance in both industrial and research settings. As the demand for advanced materials and efficient catalytic processes continues to grow, platinum(0)-1,3-divinyl-1,1,3,3-tetramethyldisiloxane will remain a key component in modern chemical manufacturing and innovation. References none |
| Market Analysis Reports |