| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 2-(1H-Indol-3-Yl)-N,N-Dimethyl-Ethanamine |
|---|---|
| Synonyms | 2-(1H-Indol-3-Yl)-N,N-Dimethyl-Ethanamine; 2-(1H-Indol-3-Yl)Ethyl-Dimethyl-Amine; Inchi=1/C12h16n2/C1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/H3-6,9,13H,7-8H2,1-2H |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 |
| CAS Registry Number | 68677-25-8 |
| SMILES | C1=CC=CC2=C1[NH]C=C2CCN(C)C |
| InChI | 1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | DMULVCHRPCFFGV-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.1±25.0°C at 760 mmHg (Cal.) |
| Flash point | 154.7±23.2°C (Cal.) |
| solubility | Soluble to 5 mM in ethanol |
| (1) | Gerald Zon. Automated synthesis of phosphorus–sulfur analogs of nucleic acids—25 years on: potential therapeutic agents and proven utility in biotechnology, New J. Chem., 2010, 34, 795. |
|---|---|
| Market Analysis Reports |