|
CAS#: 68739-90-2 Product: benzyl (2S)-2-amino-4-methylsulfanyl-butanoate, 4-methylbenzenesulfonic acid No suppilers available for the product. |
| Classification | Biochemical >> Amino acids and their derivatives >> Methionine derivatives |
|---|---|
| Name | benzyl (2S)-2-amino-4-methylsulfanyl-butanoate, 4-methylbenzenesulfonic acid |
| Synonyms | O-benzyl-L-methionine toluene-p-sulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25NO5S2 |
| Molecular Weight | 411.54 |
| CAS Registry Number | 68739-90-2 |
| EINECS | 272-130-8 |
| SMILES | OS(=O)(=O)c1ccc(C)cc1.CSCC[C@H](N)C(=O)OCc1ccccc1 |
| InChI | 1S/C12H17NO2S.C7H8O3S/c1-16-8-7-11(13)12(14)15-9-10-5-3-2-4-6-10;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,11H,7-9,13H2,1H3;2-5H,1H3,(H,8,9,10)/t11-;/m0./s1 |
| InChIKey | HVNFDGNZVKCCTM-MERQFXBCSA-N |
| Boiling point | 598°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 315.5°C (Cal.) |
| Market Analysis Reports |