|
CAS#: 6882-72-0 Product: Spegazzinine No suppilers available for the product. |
| Name | Spegazzinine |
|---|---|
| Synonyms | Spegazzinine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.46 |
| CAS Registry Number | 6882-72-0 |
| SMILES | [C@]135[C@H](N(C(=O)C)C2=C(O)C=CC=C12)[C@H](C[C@@]4([C@H]3N(CCC4)CC5)CC)O |
| InChI | 1S/C21H28N2O3/c1-3-20-8-5-10-22-11-9-21(19(20)22)14-6-4-7-15(25)17(14)23(13(2)24)18(21)16(26)12-20/h4,6-7,16,18-19,25-26H,3,5,8-12H2,1-2H3/t16-,18+,19+,20+,21+/m0/s1 |
| InChIKey | RQFIKBUKOZJEMU-OUJGAGHGSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.294°C at 760 mmHg (Cal.) |
| Flash point | 308.38°C (Cal.) |
| (1) | Lajiness James P., Jiang Wanlong, Boger Dale L.. Divergent Total Syntheses of (−)-Aspidospermine and (+)-Spegazzinine, Organic Letters, 2012 |
|---|---|
| Market Analysis Reports |