|
CAS#: 68890-81-3 Product: 2,5-Furandione, Polymer With Ethenylbenzene, Propyl Ester No suppilers available for the product. |
| Name | 2,5-Furandione, Polymer With Ethenylbenzene, Propyl Ester |
|---|---|
| Synonyms | Furan-2,5-Quinone; Propan-1-Ol; Styrene; Ethenylbenzene; Furan-2,5-Dione; Propan-1-Ol |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 |
| CAS Registry Number | 68890-81-3 |
| SMILES | O=C1OC(=O)C=C1.C(O)CC.C2=C(C=CC=C2)C=C |
| InChI | 1S/C8H8.C4H2O3.C3H8O/c1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3;1-2-3-4/h2-7H,1H2;1-2H;4H,2-3H2,1H3 |
| InChIKey | LZADGSCMOZFBDF-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |