|
CAS#: 68988-72-7 Product: Decanoic acid, mixed diesters with octanoic acid and propylene glycol No suppilers available for the product. |
| Name | Decanoic acid, mixed diesters with octanoic acid and propylene glycol |
|---|---|
| Synonyms | Capric Acid; Caprylic Acid; Propane-1,2-Diol; Caprylic, Capric Acid, Propylene Glycol Diester; Decanoic Acid, Mixed Diesters With Octanoic Acid And Propylene Glycol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H44O6 |
| Molecular Weight | 392.58 |
| CAS Registry Number | 68988-72-7 (69155-39-1) |
| SMILES | C(C(=O)O)CCCCCCCC.C(C(=O)O)CCCCCC.C(O)C(O)C |
| InChI | 1S/C10H20O2.C8H16O2.C3H8O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-3(5)2-4/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);3-5H,2H2,1H3 |
| InChIKey | YZWQUQVFVLJWCS-UHFFFAOYSA-N |
| Boiling point | 269.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121.8°C (Cal.) |
| Market Analysis Reports |