| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1-Benzylisoquinoline |
|---|---|
| Synonyms | 1-(Benzyl)Isoquinoline; Isoquinoline, 1-Benzyl-; Isoquinoline, 1-(Phenylmethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 |
| CAS Registry Number | 6907-59-1 |
| SMILES | C3=C(CC1=C2C(=CC=N1)C=CC=C2)C=CC=C3 |
| InChI | 1S/C16H13N/c1-2-6-13(7-3-1)12-16-15-9-5-4-8-14(15)10-11-17-16/h1-11H,12H2 |
| InChIKey | IZTUINVRJSCOIR-UHFFFAOYSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.074°C at 760 mmHg (Cal.) |
| Flash point | 162.675°C (Cal.) |
| (1) | Kenneth W. Bentley. β-Phenylethylamines and the isoquinoline alkaloids, Nat. Prod. Rep., 2004, 21, 395. |
|---|---|
| Market Analysis Reports |