|
CAS#: 69169-71-7 Product: 8-Methoxy-4-methyl-2H-benzo[g]chromen-2-one No suppilers available for the product. |
| Name | 8-Methoxy-4-methyl-2H-benzo[g]chromen-2-one |
|---|---|
| Synonyms | 4-methyl-8-methoxy-2-oxo-2H-benzo[g]benzopyran; 8-Methoxy-4-methylbenzo[g]coumarin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25 |
| CAS Registry Number | 69169-71-7 |
| SMILES | CC1=CC(=O)OC2=C1C=C3C=CC(=CC3=C2)OC |
| InChI | 1S/C15H12O3/c1-9-5-15(16)18-14-8-11-6-12(17-2)4-3-10(11)7-13(9)14/h3-8H,1-2H3 |
| InChIKey | GWFUYESISQUIHB-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 221°C (Expl.) |
| Boiling point | 438.1±30.0°C at 760 mmHg (Cal.) |
| Flash point | 187.1±19.2°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Atsushi Kobayashi, Kazuyuki Takehira, Toshitada Yoshihara, Seiichi Uchiyama and Seiji Tobita. Remarkable fluorescence enhancement of benzo[g]chromen-2-ones induced by hydrogen-bonding interactions with protic solvents, Photochem. Photobiol. Sci., 2012, 11, 1368. |
|---|---|
| Market Analysis Reports |