| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-(1,5-Dimethyl-4-Hexenyl)-5-Methyl-Phenol |
|---|---|
| Synonyms | 2-[(1R)-1,5-Dimethylhex-4-Enyl]-5-Methyl-Phenol; 2-[(1R)-1,5-Dimethylhex-4-Enyl]-5-Methylphenol; Curcuphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 69301-27-5 |
| SMILES | [C@H](C1=CC=C(C=C1O)C)(CCC=C(C)C)C |
| InChI | 1S/C15H22O/c1-11(2)6-5-7-13(4)14-9-8-12(3)10-15(14)16/h6,8-10,13,16H,5,7H2,1-4H3/t13-/m1/s1 |
| InChIKey | BTXSROVNGICYFE-CYBMUJFWSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.959°C at 760 mmHg (Cal.) |
| Flash point | 144.082°C (Cal.) |
| (1) | Hisahiro Hagiwara, Tomoyuki Okabe, Hiroki Ono, Vijayendra P. KamatOn leave from Goa University, India., Takashi Hoshi, Toshio Suzuki and Masayoshi Ando. Total synthesis of bisabolane sesquiterpenoids, a-bisabol-1-one, curcumene, curcuphenol and elvirol: utility of catalytic enamine reaction in cyclohexenone synthesis, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 895. |
|---|---|
| Market Analysis Reports |