| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,2R,4S,6R)-6-Amino-1,2,4-cyclohexanetriol |
|---|---|
| Synonyms | (−)-(1S,2R,4S,6R)-6-Aminocyclohexane-1,2,4-triol; (1S,2R,4S,6R)-6-aminocyclohexane-1,2,4-triol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 |
| CAS Registry Number | 696616-97-4 |
| SMILES | C1[C@@H](C[C@H]([C@H]([C@@H]1N)O)O)O |
| InChI | 1S/C6H13NO3/c7-4-1-3(8)2-5(9)6(4)10/h3-6,8-10H,1-2,7H2/t3-,4+,5+,6-/m0/s1 |
| InChIKey | AJPMRDGSYGSEND-KCDKBNATSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 138.4±27.9°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| (1) | David J. Miller, M. Bashir-Uddin Surfraz, Mahmoud Akhtar, David Gani and Rudolf K. Allemann. Removal of the phosphate group in mechanism-based inhibitors of inositol monophosphatase leads to unusual inhibitory activity, Org. Biomol. Chem., 2004, 2, 671. |
|---|---|
| Market Analysis Reports |