| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Synchem OHG | Germany | |||
|---|---|---|---|---|
![]() |
+49 (5662) 40873-0 | |||
![]() |
info@synchem.de | |||
| Chemical manufacturer | ||||
| Name | 5,5-Dichlorobarbituric Acid |
|---|---|
| Synonyms | 5,5-Dichlorohexahydropyrimidine-2,4,6-Trione; 5,5-Dichlorobarbituric Acid; Zinc02524496 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H2Cl2N2O3 |
| Molecular Weight | 196.98 |
| CAS Registry Number | 699-40-1 |
| SMILES | O=C1C(C(=O)NC(=O)N1)(Cl)Cl |
| InChI | 1S/C4H2Cl2N2O3/c5-4(6)1(9)7-3(11)8-2(4)10/h(H2,7,8,9,10,11) |
| InChIKey | REGZNRJTBVIGMJ-UHFFFAOYSA-N |
| Density | 1.84g/cm3 (Cal.) |
|---|---|
| (1) | Thomas Gelbrich, Denise Rossi, Clemens A. Häfele and Ulrich J. Griesser. Barbiturates with hydrogen-bonded layer and framework structures, CrystEngComm, 2011, 13, 5502. |
|---|---|
| Market Analysis Reports |