| Acesys Pharmatech | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | L-Histidine-2,5-3H |
|---|---|
| Synonyms | 2-Amino-3-(3H-Imidazol-4-Yl)Propionic Acid; 1H-Imidazole-4-Propanoic Acid, .Alpha.-Amino-, (S)-; L-(-)-Histidine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 |
| CAS Registry Number | 7006-35-1 |
| SMILES | C1=C([NH]C=N1)CC(N)C(O)=O |
| InChI | 1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) |
| InChIKey | HNDVDQJCIGZPNO-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.872°C at 760 mmHg (Cal.) |
| Flash point | 231.318°C (Cal.) |
| (1) | Vanessa Incani, Afsaneh Lavasanifar and Hasan Uludağ. Lipid and hydrophobic modification of cationic carriers on route to superior gene vectors, Soft Matter, 2010, 6, 2124. |
|---|---|
| Market Analysis Reports |