| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Name | 2,2'-[2,2-Dimethyl-1,3-Propanediylbis(Oxycarbonyl)]Bis(Benzoic Acid 6-Methylheptyl) Ester |
|---|---|
| Synonyms | Benzene-1,2-Dicarboxylic Acid Bis(6-Methylheptyl) Ester; Diisooctyl 1,2-Benzenedicarboxylate; Diop |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 |
| CAS Registry Number | 71097-28-4 (41375-90-0) |
| SMILES | C1=CC=C(C(=C1)C(OCCCCCC(C)C)=O)C(OCCCCCC(C)C)=O |
| InChI | 1S/C24H38O4/c1-19(2)13-7-5-11-17-27-23(25)21-15-9-10-16-22(21)24(26)28-18-12-6-8-14-20(3)4/h9-10,15-16,19-20H,5-8,11-14,17-18H2,1-4H3 |
| InChIKey | IJFPVINAQGWBRJ-UHFFFAOYSA-N |
| Density | 0.983 (Expl.) |
|---|---|
| 1.0±0.1g/cm3 (Cal.) | |
| Boiling point | 384.9±10.0°C at 760 mmHg (Cal.) |
| Flash point | 204.5±8.5°C (Cal.) |
| (1) | Hongyuan Yan, Baomi Liu, Jingjing Du and Kyung Ho Row. Simultaneous determination of four phthalate esters in bottled water using ultrasound-assisted dispersive liquid–liquid microextraction followed by GC-FID detection, Analyst, 2010, 135, 2585. |
|---|---|
| Market Analysis Reports |