| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts |
|---|---|
| Name | 4'-Ethyl-3'-Methylacetanilide |
| Synonyms | N-(4-Ethyl-3-Methyl-Phenyl)Acetamide; N-(4-Ethyl-3-Methyl-Phenyl)Ethanamide; Nsc72335 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 7149-81-7 |
| SMILES | C1=CC(=CC(=C1CC)C)NC(C)=O |
| InChI | 1S/C11H15NO/c1-4-10-5-6-11(7-8(10)2)12-9(3)13/h5-7H,4H2,1-3H3,(H,12,13) |
| InChIKey | OUXARLZHLGUCCQ-UHFFFAOYSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.984°C at 760 mmHg (Cal.) |
| Flash point | 193.763°C (Cal.) |
| Market Analysis Reports |