|
CAS#: 7182-99-2 Product: Ethyl 4-[(Phenylmethylene)Amino]Benzoate No suppilers available for the product. |
| Name | Ethyl 4-[(Phenylmethylene)Amino]Benzoate |
|---|---|
| Synonyms | Ethyl 4-(Phenylmethyleneamino)Benzoate; 4-(Phenylmethyleneamino)Benzoic Acid Ethyl Ester; 4-(Benzylideneamino)Benzoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 |
| CAS Registry Number | 7182-99-2 |
| EINECS | 230-549-3 |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=C(C=C2)C(=O)OCC |
| InChI | 1S/C16H15NO2/c1-2-19-16(18)14-8-10-15(11-9-14)17-12-13-6-4-3-5-7-13/h3-12H,2H2,1H3 |
| InChIKey | UEDPIABBBXACGR-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.176°C at 760 mmHg (Cal.) |
| Flash point | 176.48°C (Cal.) |
| (1) | Tabei K, Saitou E. Infrared absorption bands of benzalanilines observed in the 1200-850 cm-1 region, Bulletin of the Chemical Society of Japan, 1969, 42, 2693-2694 |
|---|---|
| Market Analysis Reports |