| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | alpha-Vinylbenzyl Acetate |
|---|---|
| Synonyms | Acetic Acid 1-Phenylprop-2-Enyl Ester; 1-Phenylprop-2-Enyl Ethanoate; St5446655 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 |
| CAS Registry Number | 7217-71-2 |
| EINECS | 230-606-2 |
| SMILES | C1=C(C(OC(C)=O)C=C)C=CC=C1 |
| InChI | 1S/C11H12O2/c1-3-11(13-9(2)12)10-7-5-4-6-8-10/h3-8,11H,1H2,2H3 |
| InChIKey | WAUKBOOEPYNAGU-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.408°C at 760 mmHg (Cal.) |
| Flash point | 103.792°C (Cal.) |
| (1) | Kawatsura Motoi. Retention of regiochemistry of monosubstituted allyl acetates in the ruthenium catalysed allylic alkylation with malonate anion, Chemical Communications, 2007 |
|---|---|
| Market Analysis Reports |