| Sinocure Chemical Group | China | |||
|---|---|---|---|---|
![]() | www.sinocurechem.com | |||
![]() | +86 15550440621 | |||
![]() | info@sinocurechem.com | |||
| Chemical manufacturer since 2020 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Alcohol |
|---|---|
| Name | 3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol |
| Synonyms | alpha-Hydro-omega-Hydroxy-Polyoxy(Methyl-1,2-Ethanediyl) Ether With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol (4:1) 2-Hydroxy-3-Mercaptopropyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C20H44O10S |
| Molecular Weight | 476.62 |
| CAS Registry Number | 72244-98-5 |
| EC Number | 615-735-8 |
| SMILES | C(CO)COCC(COCCCO)(COCCCO)COCCCO.C(C(CS)O)O |
| Boiling point | 534.2 °C (760 mmHg), Calc. |
|---|---|
| Flash point | 276.9 °C, Calc. |
| Hazard Symbols | |||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H317-H412 Details | ||||||||||||||||||||||||||||
| Safety Statements | P261-P272-P273-P280-P302+P352-P321-P333+P317-P362+P364-P501 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
|
3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol is a multifaceted chemical compound notable for its complex structure and diverse applications. This substance, recognized for its intricate arrangement of functional groups, plays a significant role in various industrial and research fields due to its unique properties. The discovery of this compound emerged from the need for advanced materials with specific functional characteristics. Its structure includes multiple hydroxypropoxy and hydroxypropoxymethyl groups, which confer solubility and reactivity, while the sulfanyl group enhances its potential in specific chemical reactions and applications. This combination of functional groups allows the compound to interact effectively with different substrates, making it a valuable component in various formulations. In practical applications, 3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol is primarily used in the development of specialty polymers and resins. Its ability to act as a crosslinker or reactive diluent in polymer systems makes it suitable for producing high-performance materials. The compound's functional groups contribute to enhanced bonding and stability in polymer networks, leading to improved mechanical properties and durability of the final products. In the field of coatings, this compound is utilized to formulate advanced protective coatings with excellent adhesion, flexibility, and resistance to environmental factors. Its presence in coating formulations helps achieve desired properties such as improved scratch resistance and enhanced chemical resistance, making it suitable for various applications, including automotive finishes and industrial protective coatings. Additionally, the compound is explored for its potential use in pharmaceuticals and cosmetics due to its unique chemical features. Its compatibility with different biological systems and its reactivity make it a candidate for developing new drug delivery systems and cosmetic formulations that require specific interactions with biological or environmental elements. Research continues into optimizing the applications of 3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol, focusing on enhancing its efficiency and discovering new uses. As industries seek more specialized and effective materials, this compound's role is likely to expand, contributing to advancements in various technological and scientific fields. References none |
| Market Analysis Reports |