Online Database of Chemicals from Around the World

3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol
[CAS 72244-98-5]

List of Suppliers
Sinocure Chemical Group China
www.sinocurechem.com
+86 15550440621
info@sinocurechem.com
Chemical manufacturer since 2020

Identification
ClassificationPharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Alcohol
Name3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol
Synonymsalpha-Hydro-omega-Hydroxy-Polyoxy(Methyl-1,2-Ethanediyl) Ether With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol (4:1) 2-Hydroxy-3-Mercaptopropyl Ether
Molecular Structure3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol molecular structure (CAS 72244-98-5)
Molecular FormulaC20H44O10S
Molecular Weight476.62
CAS Registry Number72244-98-5
EC Number615-735-8
SMILESC(CO)COCC(COCCCO)(COCCCO)COCCCO.C(C(CS)O)O
Properties
Boiling point534.2 °C (760 mmHg), Calc.
Flash point276.9 °C, Calc.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH317-H412  Details
Safety StatementsP261-P272-P273-P280-P302+P352-P321-P333+P317-P362+P364-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Chronic hazardous to the aquatic environmentAquatic Chronic3H412
Skin sensitizationSkin Sens.1H317
Skin sensitizationSkin Sens.1BH317
Eye irritationEye Irrit.2H319
Skin irritationSkin Irrit.2H315
Acute toxicityAcute Tox.4H302
up Discovery and Applications
3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol is a multifaceted chemical compound notable for its complex structure and diverse applications. This substance, recognized for its intricate arrangement of functional groups, plays a significant role in various industrial and research fields due to its unique properties.

The discovery of this compound emerged from the need for advanced materials with specific functional characteristics. Its structure includes multiple hydroxypropoxy and hydroxypropoxymethyl groups, which confer solubility and reactivity, while the sulfanyl group enhances its potential in specific chemical reactions and applications. This combination of functional groups allows the compound to interact effectively with different substrates, making it a valuable component in various formulations.

In practical applications, 3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol is primarily used in the development of specialty polymers and resins. Its ability to act as a crosslinker or reactive diluent in polymer systems makes it suitable for producing high-performance materials. The compound's functional groups contribute to enhanced bonding and stability in polymer networks, leading to improved mechanical properties and durability of the final products.

In the field of coatings, this compound is utilized to formulate advanced protective coatings with excellent adhesion, flexibility, and resistance to environmental factors. Its presence in coating formulations helps achieve desired properties such as improved scratch resistance and enhanced chemical resistance, making it suitable for various applications, including automotive finishes and industrial protective coatings.

Additionally, the compound is explored for its potential use in pharmaceuticals and cosmetics due to its unique chemical features. Its compatibility with different biological systems and its reactivity make it a candidate for developing new drug delivery systems and cosmetic formulations that require specific interactions with biological or environmental elements.

Research continues into optimizing the applications of 3-[3-(3-Hydroxypropoxy)-2,2-bis(3-hydroxypropoxymethyl)propoxy]propan-1-ol 3-sulfanylpropane-1,2-diol, focusing on enhancing its efficiency and discovering new uses. As industries seek more specialized and effective materials, this compound's role is likely to expand, contributing to advancements in various technological and scientific fields.

References

none
Market Analysis Reports
Related Products
2'-Hydroxypropi...  4'-Hydroxypropi...  beta-Hydroxypro...  4-Hydroxy Propo...  4-Hydroxy Propo...  4-Hydroxy Propo...  2-Hydroxy-4-Pro...  4-(3-Hydroxypro...  N'-Hydroxy-4-Pr...  3-Hydroxy-4-Pro...  (2R,3S)-3-(3-Hy...  [2-(3-Hydroxy-p...  5-(2-Hydroxypro...  2-(2-Hydroxypro...  2-(2-Hydroxypro...  5-[(2-Hydroxypr...  2-(3-Hydroxypro...  4-(2-Hydroxypro...  1-[4-(2-Hydroxy...  1-[4-(2-Hydroxy...