| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Discovery Fine Chemicals Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1202) 874-517 | |||
![]() |
pjc@discofinechem.com | |||
| Chemical manufacturer | ||||
| Name | Methylarsonous acid |
|---|---|
| Synonyms | arsonous acid, methyl-; C406082; InChI=1/CH5AsO2/c1-2(3)4/h3-4H,1H3 |
| Molecular Structure | ![]() |
| Molecular Formula | CH5AsO2 |
| Molecular Weight | 123.97 |
| CAS Registry Number | 72814-84-7 |
| SMILES | C[As](O)O |
| InChI | 1S/CH5AsO2/c1-2(3)4/h3-4H,1H3 |
| InChIKey | OXBIRPQQKCQWGV-UHFFFAOYSA-N |
| Boiling point | 202.9±23.0°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100.0±17.2°C (Cal.) |
| (1) | A. Lennartson and M. HÃ¥kansson. Investigation of commercial sodium cacodylate trihydrate: penta-[mu]-aqua-disodium(I) bis(dimethylarsenate) and di-[mu]-aqua-bis[triaquasodium(I)] bis(dimethylarsenate), Acta Cryst. (2008). C64, m13-m16 |
|---|---|
| Market Analysis Reports |