| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 315-5062 / (877) 786-1922 | |||
![]() |
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (RS)-4-Carboxyphenylglycine |
|---|---|
| Synonyms | 4-(1-Amino-2-Hydroxy-2-Oxo-Ethyl)Benzoic Acid; 4-(1-Amino-2-Hydroxy-2-Keto-Ethyl)Benzoic Acid; (S)-4-Carboxyphenylglycine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 |
| CAS Registry Number | 7292-81-1 |
| SMILES | C1=CC(=CC=C1C(C(O)=O)N)C(O)=O |
| InChI | 1S/C9H9NO4/c10-7(9(13)14)5-1-3-6(4-2-5)8(11)12/h1-4,7H,10H2,(H,11,12)(H,13,14) |
| InChIKey | VTMJKPGFERYGJF-UHFFFAOYSA-N |
| Density | 1.458g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.973°C at 760 mmHg (Cal.) |
| Flash point | 212.631°C (Cal.) |
| solubility | Soluble to 100 mM in 1eq. NaOH and to 5 mM in water |
| Market Analysis Reports |