| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2,6-Dioxo-3H-Pyrimidine-4-Carboxylate |
|---|---|
| Synonyms | 2,6-Diketo-3H-Pyrimidine-4-Carboxylate; Zinc00895161; 2,6-Dioxo-1,2,3,6-Tetrahydropyrimidine-4-Carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H3N2O4 |
| Molecular Weight | 155.09 |
| CAS Registry Number | 73-97-2 |
| SMILES | O=C1NC(=CC(=O)N1)C([O-])=O |
| InChI | 1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)/p-1 |
| InChIKey | PXQPEWDEAKTCGB-UHFFFAOYSA-M |
| (1) | Okan Z. Yeşilel, Hakan Erer and Orhan Büyükgüngör. Supramolecular architectures of cadmium(ii)-orotate complexes containing water clusters, CrystEngComm, 2011, 13, 1339. |
|---|---|
| Market Analysis Reports |