| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | 2'-Deoxy-8-(9H-Fluoren-2-Ylamino)-Guanosine |
|---|---|
| Synonyms | 2-Amino-8-(9H-Fluoren-2-Ylamino)-9-[(2R,4S,5R)-4-Hydroxy-5-(Hydroxymethyl)Tetrahydrofuran-2-Yl]-3H-Purin-6-One; 2-Amino-8-(9H-Fluoren-2-Ylamino)-9-[(2R,4S,5R)-4-Hydroxy-5-(Hydroxymethyl)-2-Tetrahydrofuranyl]-3H-Purin-6-One; 2-Amino-8-(9H-Fluoren-2-Ylamino)-9-[(2R,4S,5R)-4-Hydroxy-5-Methylol-Tetrahydrofuran-2-Yl]-3H-Purin-6-One |
| Molecular Structure | ![]() |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.46 |
| CAS Registry Number | 73051-69-1 |
| SMILES | [C@@H]6([N]1C(=NC2=C1NC(=NC2=O)N)NC5=CC4=C(C3=CC=CC=C3C4)C=C5)O[C@@H]([C@H](C6)O)CO |
| InChI | 1S/C23H22N6O4/c24-22-27-20-19(21(32)28-22)26-23(29(20)18-9-16(31)17(10-30)33-18)25-13-5-6-15-12(8-13)7-11-3-1-2-4-14(11)15/h1-6,8,16-18,30-31H,7,9-10H2,(H,25,26)(H3,24,27,28,32)/t16-,17+,18+/m0/s1 |
| InChIKey | RMYQNJYFBAYPNG-RCCFBDPRSA-N |
| Density | 1.743g/cm3 (Cal.) |
|---|---|
| Boiling point | 822.095°C at 760 mmHg (Cal.) |
| Flash point | 450.987°C (Cal.) |
| (1) | Linlin Zhao, John B. Schenkman and James F. Rusling. Screening for reactive metabolites using electro-optical arrays featuring human liver cytosol and microsomal enzyme sources and DNA, Chem. Commun., 2009, 5386. |
|---|---|
| Market Analysis Reports |