| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | beta-D-Mannopyranose |
|---|---|
| Synonyms | (2R,3S,4S,5S,6R)-6-(Hydroxymethyl)Tetrahydropyran-2,3,4,5-Tetrol; (2R,3S,4S,5S,6R)-6-Methyloltetrahydropyran-2,3,4,5-Tetrol; Mannose-B |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 |
| CAS Registry Number | 7322-31-8 |
| SMILES | [C@@H]1([C@H]([C@H](O)[C@H](O[C@H]1O)CO)O)O |
| InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6-/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-RWOPYEJCSA-N |
| Density | 1.732g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.797°C at 760 mmHg (Cal.) |
| Flash point | 202.243°C (Cal.) |
| (1) | Stanislav KozmonAuthor is on the leave of Institute of Chemistry—Center for Glycomics, Slovak Academy of Sciences, Dúbravská cesta 9, 845 38 Bratislava, Slovakia., Radek Matuška, Vojtěch Spiwok and Jaroslav Koča. Dispersion interactions of carbohydrates with condensate aromatic moieties: Theoretical study on the CH–π interaction additive properties, Phys. Chem. Chem. Phys., 2011, 13, 14215. |
|---|---|
| Market Analysis Reports |