|
CAS#: 73332-73-7 Product: 1-(2,4-Dinitroimidazol-1-Yl)Propan-2-Ol No suppilers available for the product. |
| Name | 1-(2,4-Dinitroimidazol-1-Yl)Propan-2-Ol |
|---|---|
| Synonyms | 1-(2,4-Dinitro-1-Imidazolyl)Propan-2-Ol; Aids-059083; Aids059083 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8N4O5 |
| Molecular Weight | 216.15 |
| CAS Registry Number | 73332-73-7 |
| SMILES | C1=C(N=C([N]1CC(O)C)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C6H8N4O5/c1-4(11)2-8-3-5(9(12)13)7-6(8)10(14)15/h3-4,11H,2H2,1H3 |
| InChIKey | WLAGHFMQUTYMAZ-UHFFFAOYSA-N |
| Density | 1.752g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.79°C at 760 mmHg (Cal.) |
| Flash point | 250.621°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |