| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Methyl-6-Nitro-2,3-Dihydroimidazo[2,1-b][1,3]Oxazole |
|---|---|
| Synonyms | 2-Methyl-6-Nitro-2,3-Dihydroimidazo[2,1-B]Oxazole; Imidazo(2,1-B)Oxazole, 2,3-Dihydro-2-Methyl-6-Nitro-; Aids-027875 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 |
| CAS Registry Number | 73332-75-9 |
| SMILES | C1=C(N=C2OC(C[N]12)C)[N+]([O-])=O |
| InChI | 1S/C6H7N3O3/c1-4-2-8-3-5(9(10)11)7-6(8)12-4/h3-4H,2H2,1H3 |
| InChIKey | NUCGDAFGCCIOTC-UHFFFAOYSA-N |
| Density | 1.716g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.651°C at 760 mmHg (Cal.) |
| Flash point | 155.587°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |