|
CAS#: 73332-76-0 Product: 2-(Chloromethyl)-6-Nitro-2,3-Dihydroimidazo[2,1-b][1,3]Oxazole No suppilers available for the product. |
| Name | 2-(Chloromethyl)-6-Nitro-2,3-Dihydroimidazo[2,1-b][1,3]Oxazole |
|---|---|
| Synonyms | 2-(Chloromethyl)-6-Nitro-2,3-Dihydroimidazo[2,1-B]Oxazole; Imidazo[2,1-B]Oxazole, 2-(Chloromethyl)-2,3-Dihydro-6-Nitro-; Imidazo(2,1-B)Oxazole, 2-(Chloromethyl)-2,3-Dihydro-6-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6ClN3O3 |
| Molecular Weight | 203.58 |
| CAS Registry Number | 73332-76-0 |
| SMILES | C1=C(N=C2OC(C[N]12)CCl)[N+]([O-])=O |
| InChI | 1S/C6H6ClN3O3/c7-1-4-2-9-3-5(10(11)12)8-6(9)13-4/h3-4H,1-2H2 |
| InChIKey | AMEBFJJGPLVLCN-UHFFFAOYSA-N |
| Density | 1.871g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.019°C at 760 mmHg (Cal.) |
| Flash point | 195.725°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |