| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 4-[(3-Nitrophenyl)Methylideneamino]Benzoate |
|---|---|
| Synonyms | Ethyl 4-[(3-Nitrophenyl)Methyleneamino]Benzoate; 4-[(3-Nitrophenyl)Methyleneamino]Benzoic Acid Ethyl Ester; 4-[(3-Nitrobenzylidene)Amino]Benzoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 |
| CAS Registry Number | 73713-67-4 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1C=NC2=CC=C(C(=O)OCC)C=C2 |
| InChI | 1S/C16H14N2O4/c1-2-22-16(19)13-6-8-14(9-7-13)17-11-12-4-3-5-15(10-12)18(20)21/h3-11H,2H2,1H3 |
| InChIKey | CFHPLYRQKPLRNN-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.795°C at 760 mmHg (Cal.) |
| Flash point | 236.11°C (Cal.) |
| (1) | Minkin V I, Bren V A. Basicity and structure of azomethines and their structural analogs, Organic Reactivity, 1967, 4, 45-51 |
|---|---|
| Market Analysis Reports |