| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Sarchem Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 708-1777 | |||
![]() |
sarchem@aol.com | |||
| Chemical manufacturer since 1984 | ||||
| Name | Triethanolamine |
|---|---|
| Synonyms | Triethanolamine Sulfate; Sulfuric Acid, Mono-C10-16-Alkyl Esters, Compds. With Triethanolamine; Sulfuric Acid, Mono-C1o-16-Alkyl Esters, Compds. With Triethanolamine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H17NO7S |
| Molecular Weight | 247.26 |
| CAS Registry Number | 7376-31-0 |
| EINECS | 230-934-6 |
| SMILES | C(N(CCO)CCO)CO.O=[S](O)(O)=O |
| InChI | 1S/C6H15NO3.H2O4S/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;(H2,1,2,3,4) |
| InChIKey | RZRILSWMGXWSJY-UHFFFAOYSA-N |
| Boiling point | 335.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 185°C (Cal.) |
| Market Analysis Reports |