|
CAS#: 73932-63-5 Product: 2-Chloro-1-[4-(2-Phenylethyl)Phenyl]Ethan-1-One No suppilers available for the product. |
| Name | 2-Chloro-1-[4-(2-Phenylethyl)Phenyl]Ethan-1-One |
|---|---|
| Synonyms | 2-Chloro-1-(4-(2-Phenylethyl)Phenyl)Ethan-1-One; Aids-209686; Aids209686 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.75 |
| CAS Registry Number | 73932-63-5 |
| EINECS | 277-643-0 |
| SMILES | C1=C(C(=O)CCl)C=CC(=C1)CCC2=CC=CC=C2 |
| InChI | 1S/C16H15ClO/c17-12-16(18)15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-5,8-11H,6-7,12H2 |
| InChIKey | CKNPQHZYZCDMFH-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.516°C at 760 mmHg (Cal.) |
| Flash point | 222.07°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |