|
CAS#: 7402-58-6 Product: N-(Benzo[1,3]Dioxol-5-Ylmethylene)-p-Tolyl-Amine No suppilers available for the product. |
| Name | N-(Benzo[1,3]Dioxol-5-Ylmethylene)-p-Tolyl-Amine |
|---|---|
| Synonyms | 1,3-Benzodioxol-5-Ylmethylene-(4-Methylphenyl)Amine; Nsc55348; Zinc00047873 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 |
| CAS Registry Number | 7402-58-6 |
| SMILES | C2=C(C=NC1=CC=C(C=C1)C)C=CC3=C2OCO3 |
| InChI | 1S/C15H13NO2/c1-11-2-5-13(6-3-11)16-9-12-4-7-14-15(8-12)18-10-17-14/h2-9H,10H2,1H3 |
| InChIKey | QXQWZMAEJYCEIG-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.489°C at 760 mmHg (Cal.) |
| Flash point | 153.227°C (Cal.) |
| (1) | Echevarria A, Graça Nascimento M, Gerônimo V, Miller J, and Giesbrecht A. NMR spectroscopy, Hammett correlations and biological activity of some Schiff bases derived from piperonal, Journal of the Brazilian Chemical Society, 1999, 10(1), 60-64 |
|---|---|
| Market Analysis Reports |