| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3,6-Bis(2-chlorophenyl)-1,2-dihydro-1,2,4,5-tetrazine |
|---|---|
| Synonyms | 3,6-BIS(2-CHLOROPHENYL)-1,2-DIHYDRO-1,2,4,5-TETRAZINE |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Cl2N4 |
| Molecular Weight | 305.16 |
| CAS Registry Number | 74115-15-4 |
| SMILES | Clc3ccccc3C=1NN/C(=N\N=1)c2ccccc2Cl |
| InChI | 1S/C14H10Cl2N4/c15-11-7-3-1-5-9(11)13-17-19-14(20-18-13)10-6-2-4-8-12(10)16/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | DMOSPPXFAKVBOQ-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.586°C at 760 mmHg (Cal.) |
| Flash point | 211.792°C (Cal.) |
| (1) | J. Zachara, I. Madura and M. Wlostowski. Hydrogen-bonding patterns in two structural isomers of 3,6-bis(2-chlorophenyl)-1,4-dihydro-1,2,4,5-tetrazine, Acta Cryst. (2004). C60, o57-o59 |
|---|---|
| Market Analysis Reports |