Online Database of Chemicals from Around the World
2-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
[CAS 741709-60-4]
Identification| Name | 2-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C13H20BNO2 |
| Molecular Weight | 233.11 |
| CAS Registry Number | 741709-60-4 |
| EC Number | 854-158-8 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)CC |
|
Properties
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.489, Calc.* |
| Boiling Point | 328.6±30.0 °C (760 mmHg), Calc.* |
| Flash Point | 152.5±24.6 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Acute toxicity | Acute Tox. | 4 | H302 |
| Eye irritation | Eye Irrit. | 2 | H319 |
| Specific target organ toxicity - single exposure | STOT SE | 3 | H335 |
| Skin irritation | Skin Irrit. | 2 | H315 |
|
| SDS | Available |
|
Related Products
Ethyl 2-[4-(4,4... Ethyl 4-(4,4,5,... 3-Ethyl-5-(4,4,... Ethyl 5-(4,4,5,... Ethyl 6-(4,4,5,... Ethyl 7-(4,4,5,... Ethyl 2-[4-(4,4... Ethyl (E)-3-(4,... Ethyl 3-(4,4,5,... Ethyl [4-(4,4,5... 2-Ethyl-5-(4,4,... Ethyl 4-(4,4,5,... 2-Ethyl-1,1,6,6... 4-Ethyl-2,2,6,6... 6-Ethyl-4,6,8,8... 8-Ethyl-4,6,6,8... 4-Ethyl-1,2,2,5... Ethyl (1R,5R,6R... 1-Ethyl-2,3,5,6... 1-Ethyl-2,2,6,6...