| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (919) 678-0702 | |||
![]() |
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | Methyl 6-O-[dimethyl(2-methyl-2-propanyl)silyl]-alpha-D-mannopyranoside |
|---|---|
| Synonyms | METHYL-A-D-6-O-T-BUTYLDIMETHYL-MANNOPYRANOSIDE; Methyl-a-D-6-O-t-Butyldimethyl-Mannopyranoside. |
| Molecular Structure | ![]() |
| Molecular Formula | C13H28O6Si |
| Molecular Weight | 308.44 |
| CAS Registry Number | 74247-81-7 |
| SMILES | O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1OC |
| InChI | 1S/C13H28O6Si/c1-13(2,3)20(5,6)18-7-8-9(14)10(15)11(16)12(17-4)19-8/h8-12,14-16H,7H2,1-6H3/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | PJPAPOCZOTYLIT-GCHJQGSQSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.396°C at 760 mmHg (Cal.) |
| Flash point | 180.833°C (Cal.) |
| (1) | Sun et al.. Catalyst recognition of cis-1,2-diols enables site-selective functionalization of complex molecules, Nature Chemistry, 2013 |
|---|---|
| Market Analysis Reports |