|
CAS#: 7449-08-3 Product: 3-(2-Amino-4,6-dioxo-4,5,6,8-tetrahydro-7(1H)-pteridinylidene)-2-oxopropanoic acid No suppilers available for the product. |
| Name | 3-(2-Amino-4,6-dioxo-4,5,6,8-tetrahydro-7(1H)-pteridinylidene)-2-oxopropanoic acid |
|---|---|
| Synonyms | 3-(2-amin |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7N5O5 |
| Molecular Weight | 265.18 |
| CAS Registry Number | 7449-08-3 |
| EINECS | 231-214-4 |
| SMILES | C(=C1C(=O)NC2=C(N1)NC(=NC2=O)N)C(=O)C(=O)O |
| InChI | 1S/C9H7N5O5/c10-9-13-5-4(7(17)14-9)12-6(16)2(11-5)1-3(15)8(18)19/h1H,(H,12,16)(H,18,19)(H4,10,11,13,14,17) |
| InChIKey | BNJFLPKUALUAFG-UHFFFAOYSA-N |
| Density | 2.2±0.1g/cm3 (Cal.) |
|---|---|
| (1) | MERLINI L, NASINI G. Insect pigments—IV. Pteridines and colour in some Hemiptera☆, Journal of Insect Physiology, 1966 |
|---|---|
| Market Analysis Reports |