| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Phytantriol |
|---|---|
| Synonyms | 3,7,11,15,-Tetramethyl-1,2,3-Hexadecanetriol; Phytantriol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H42O3 |
| Molecular Weight | 330.55 |
| CAS Registry Number | 74563-64-7 |
| EINECS | 277-923-2 |
| SMILES | C(C(C(CO)O)(C)O)CCC(CCCC(CCCC(C)C)C)C |
| InChI | 1S/C20H42O3/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5,23)19(22)15-21/h16-19,21-23H,6-15H2,1-5H3 |
| InChIKey | CGIHFIDULQUVJG-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.276°C at 760 mmHg (Cal.) |
| Flash point | 195.9±17.8°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Adam Tilley, Yao-Da Dong, Heinz Amenitsch, Michael Rappolt and Ben J. Boyd. Transfer of lipid and phase reorganisation in self-assembled liquid crystal nanostructured particles based on phytantriol, Phys. Chem. Chem. Phys., 2011, 13, 3026. |
|---|---|
| Market Analysis Reports |