| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 9-Hydroxy-Phenalen-1-One |
|---|---|
| Synonyms | 9-Hydroxy-1-Phenalenone; 1H-Phenalen-1-One,9-Hydroxy-; Nsc38784 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8O2 |
| Molecular Weight | 196.21 |
| CAS Registry Number | 7465-58-9 |
| SMILES | C2=CC(=C1C3=C(C=CC1=O)C=CC=C23)O |
| InChI | 1S/C13H8O2/c14-10-6-4-8-2-1-3-9-5-7-11(15)13(10)12(8)9/h1-7,14H |
| InChIKey | HOVGVQXNLIMLNN-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.157°C at 760 mmHg (Cal.) |
| Flash point | 177.647°C (Cal.) |
| (1) | Mazzini Stefania, Merlini Lucio, Mondelli Rosanna, Nasini Gianluca, Ragg Enzio, Scaglioni Leonardo. Deuterium isotope effect on 1H and 13C chemical shifts of intramolecularly hydrogen bonded perylenequinones, Journal of the Chemical Society, Perkin Transactions 2, 1997 |
|---|---|
| Market Analysis Reports |