| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Exclusive Chemistry Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (903) 713-5556 | |||
![]() |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 2-Aminophenylphosphonic Acid |
|---|---|
| Synonyms | (O-Aminophenyl)Phosphonic Acid; 2-Aminobenzenephosphonic Acid; Brn 2937141 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8NO3P |
| Molecular Weight | 173.11 |
| CAS Registry Number | 7472-16-4 |
| SMILES | C1=CC=CC(=C1N)[P](O)(O)=O |
| InChI | 1S/C6H8NO3P/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H,7H2,(H2,8,9,10) |
| InChIKey | BMYBKYQDGKGCSU-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.025°C at 760 mmHg (Cal.) |
| Flash point | 215.686°C (Cal.) |
| (1) | Bhaskar Reddy Aluri, Basit Niaz, Markus K. Kindermann, Peter G. Jones and Joachim Heinicke. PC–N-Heterocycles: synthesis of biaryl-type 1,3-benzazaphospholes with ortho-substituted phenyl or 2-heteroaryl groups, Dalton Trans., 2011, 40, 211. |
|---|---|
| Market Analysis Reports |