| Advanced Synthesis | USA | |||
|---|---|---|---|---|
![]() |
+1 (619) 423-7821 | |||
![]() |
sales@advancedsynthesis.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bedoukian Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 830-4000 | |||
![]() |
customerservice@bedoukian.com | |||
| Chemical manufacturer since 1972 | ||||
| Interchim Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 560-8262 | |||
![]() |
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aromatic carboxylic acid ester |
|---|---|
| Name | 2-Amino-Benzoic Acid 2-Propen-1-Yl Ester |
| Synonyms | Allyl 2-Aminobenzoate; 2-Aminobenzoic Acid Allyl Ester; Allyl O-Aminobenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 |
| CAS Registry Number | 7493-63-2 |
| EINECS | 231-331-0 |
| FEMA | 2020 |
| SMILES | C1=C(C(=CC=C1)N)C(OCC=C)=O |
| InChI | 1S/C10H11NO2/c1-2-7-13-10(12)8-5-3-4-6-9(8)11/h2-6H,1,7,11H2 |
| InChIKey | UCANFCXAKYMFGA-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 105°C (Expl.) |
| 300.718°C at 760 mmHg (Cal.) | |
| Flash point | 156.125°C (Cal.) |
| Refractive index | 1.569-1.577 (Expl.) |
| Market Analysis Reports |